C17H10NO4S- — CID 59384796
2-[2-(1-benzofuran-2-yl)-5-thiophen-2-yl-1,3-oxazol-4-yl]acetate (PubChem CID 59384796) has the molecular formula C17H10NO4S- and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[2-(1-benzofuran-2-yl)-5-thiophen-2-yl-1,3-oxazol-4-yl]acetate.
| Compound Name | 2-[2-(1-benzofuran-2-yl)-5-thiophen-2-yl-1,3-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 59384796 |
| Molecular Formula | C17H10NO4S- |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-[2-(1-benzofuran-2-yl)-5-thiophen-2-yl-1,3-oxazol-4-yl]acetate |
| SMILES | O=C([O-])Cc1nc(-c2cc3ccccc3o2)oc1-c1cccs1 |
| InChI | InChI=1S/C17H11NO4S/c19-15(20)9-11-16(14-6-3-7-23-14)22-17(18-11)13-8-10-4-1-2-5-12(10)21-13/h1-8H,9H2,(H,19,20)/p-1 |
| InChIKey | UPGMFKZUJWSVLN-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 79.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |