C20H13FN3O4S2- — CID 59384885
(1Z)-2-[2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl]-N-pyridin-3-ylsulfonylethanimidate (PubChem CID 59384885) has the molecular formula C20H13FN3O4S2- and a molecular weight of 442.47 g/mol. Its IUPAC name is (1Z)-2-[2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl]-N-pyridin-3-ylsulfonylethanimidate.
| Compound Name | (1Z)-2-[2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl]-N-pyridin-3-ylsulfonylethanimidate |
|---|---|
| PubChem CID | 59384885 |
| Molecular Formula | C20H13FN3O4S2- |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | (1Z)-2-[2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl]-N-pyridin-3-ylsulfonylethanimidate |
| SMILES | O=S(=O)(/N=C(\[O-])Cc1nc(-c2ccc(F)cc2)oc1-c1ccsc1)c1cccnc1 |
| InChI | InChI=1S/C20H14FN3O4S2/c21-15-5-3-13(4-6-15)20-23-17(19(28-20)14-7-9-29-12-14)10-18(25)24-30(26,27)16-2-1-8-22-11-16/h1-9,11-12H,10H2,(H,24,25)/p-1 |
| InChIKey | PCPWRDKXPBHEDU-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 108.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|