About 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid
2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 59385022) has the molecular formula C16H12ClNO3S2
and a molecular weight of 365.86 g/mol. Its IUPAC name is 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid |
| PubChem CID | 59385022 |
| Molecular Formula | C16H12ClNO3S2 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid |
| SMILES | CSc1cccc(-c2nc(CC(=O)O)c(-c3ccc(Cl)s3)o2)c1 |
| InChI | InChI=1S/C16H12ClNO3S2/c1-22-10-4-2-3-9(7-10)16-18-11(8-14(19)20)15(21-16)12-5-6-13(17)23-12/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | WFDPNJMALKEQIG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid?
The IUPAC name of 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid (CID 59385022) is 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid.
What is the SMILES notation for 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid?
The canonical SMILES for 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid is CSc1cccc(-c2nc(CC(=O)O)c(-c3ccc(Cl)s3)o2)c1.
What is the InChIKey of 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid?
The InChIKey is WFDPNJMALKEQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNO3S2/c1-22-10-4-2-3-9(7-10)16-18-11(8-14(19)20)15(21-16)12-5-6-13(17)23-12/h2-7H,8H2,1H3,(H,19,20).
What are the key properties of 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid?
2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid has a molecular weight of 365.86 g/mol, XLogP of 5.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(5-chlorothiophen-2-yl)-2-(3-methylsulfanylphenyl)-1,3-oxazol-4-yl]acetic acid is sourced from PubChem (CID 59385022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).