C38H48O6 — CID 59386218
3-[[4-[1,1-bis[4-[(3-ethyloxetan-3-yl)methoxy]phenyl]ethyl]phenoxy]methyl]-3-ethyloxetane (PubChem CID 59386218) has the molecular formula C38H48O6 and a molecular weight of 600.80 g/mol. Its IUPAC name is 3-[[4-[1,1-bis[4-[(3-ethyloxetan-3-yl)methoxy]phenyl]ethyl]phenoxy]methyl]-3-ethyloxetane.
| Compound Name | 3-[[4-[1,1-bis[4-[(3-ethyloxetan-3-yl)methoxy]phenyl]ethyl]phenoxy]methyl]-3-ethyloxetane |
|---|---|
| PubChem CID | 59386218 |
| Molecular Formula | C38H48O6 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | 3-[[4-[1,1-bis[4-[(3-ethyloxetan-3-yl)methoxy]phenyl]ethyl]phenoxy]methyl]-3-ethyloxetane |
| SMILES | CCC1(COc2ccc(C(C)(c3ccc(OCC4(CC)COC4)cc3)c3ccc(OCC4(CC)COC4)cc3)cc2)COC1 |
| InChI | InChI=1S/C38H48O6/c1-5-36(20-39-21-36)26-42-32-14-8-29(9-15-32)35(4,30-10-16-33(17-11-30)43-27-37(6-2)22-40-23-37)31-12-18-34(19-13-31)44-28-38(7-3)24-41-25-38/h8-19H,5-7,20-28H2,1-4H3 |
| InChIKey | LADFLNYOPUYBCT-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|