C15H22O4 — CID 59386255
ethyl (2E,4E,6E)-9-ethoxy-2,7-dimethyl-8-oxonona-2,4,6-trienoate (PubChem CID 59386255) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-9-ethoxy-2,7-dimethyl-8-oxonona-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-9-ethoxy-2,7-dimethyl-8-oxonona-2,4,6-trienoate |
|---|---|
| PubChem CID | 59386255 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | ethyl (2E,4E,6E)-9-ethoxy-2,7-dimethyl-8-oxonona-2,4,6-trienoate |
| SMILES | CCOCC(=O)/C(C)=C/C=C/C=C(\C)C(=O)OCC |
| InChI | InChI=1S/C15H22O4/c1-5-18-11-14(16)12(3)9-7-8-10-13(4)15(17)19-6-2/h7-10H,5-6,11H2,1-4H3/b8-7+,12-9+,13-10+ |
| InChIKey | INXCNNXXXOPGSH-AHHMXTSASA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|