C14H21F6N3O4 — CID 59386384
ethyl 2-[bis[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]acetate (PubChem CID 59386384) has the molecular formula C14H21F6N3O4 and a molecular weight of 409.33 g/mol. Its IUPAC name is ethyl 2-[bis[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]acetate.
| Compound Name | ethyl 2-[bis[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]acetate |
|---|---|
| PubChem CID | 59386384 |
| Molecular Formula | C14H21F6N3O4 |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | ethyl 2-[bis[3-[(2,2,2-trifluoroacetyl)amino]propyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCCNC(=O)C(F)(F)F)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H21F6N3O4/c1-2-27-10(24)9-23(7-3-5-21-11(25)13(15,16)17)8-4-6-22-12(26)14(18,19)20/h2-9H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | BKISAXKWDONEPE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|