C22H26N8O — CID 59386405
N-[2-[(4,5-diisocyano-1-prop-2-enylimidazol-2-yl)diazenyl]-5-(dipropylamino)phenyl]acetamide (PubChem CID 59386405) has the molecular formula C22H26N8O and a molecular weight of 418.51 g/mol. Its IUPAC name is N-[2-[(4,5-diisocyano-1-prop-2-enylimidazol-2-yl)diazenyl]-5-(dipropylamino)phenyl]acetamide.
| Compound Name | N-[2-[(4,5-diisocyano-1-prop-2-enylimidazol-2-yl)diazenyl]-5-(dipropylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 59386405 |
| Molecular Formula | C22H26N8O |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[2-[(4,5-diisocyano-1-prop-2-enylimidazol-2-yl)diazenyl]-5-(dipropylamino)phenyl]acetamide |
| SMILES | [C-]#[N+]c1nc(/N=N/c2ccc(N(CCC)CCC)cc2NC(C)=O)n(CC=C)c1[N+]#[C-] |
| InChI | InChI=1S/C22H26N8O/c1-7-12-29(13-8-2)17-10-11-18(19(15-17)25-16(4)31)27-28-22-26-20(23-5)21(24-6)30(22)14-9-3/h9-11,15H,3,7-8,12-14H2,1-2,4H3,(H,25,31)/b28-27+ |
| InChIKey | XQVAMMWNIBCBDL-BYYHNAKLSA-N |
| XLogP | 6.17 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|