C20H38O2Si — CID 59386480
5-[(2R,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxyhept-1-ynyl-trimethylsilane (PubChem CID 59386480) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is 5-[(2R,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxyhept-1-ynyl-trimethylsilane.
| Compound Name | 5-[(2R,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxyhept-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 59386480 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 5-[(2R,4S,5R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxyhept-1-ynyl-trimethylsilane |
| SMILES | CCC(CCC#C[Si](C)(C)C)O[C@@H]1OC(CC)[C@H](C)[C@H](C)C1C |
| InChI | InChI=1S/C20H38O2Si/c1-9-18(13-11-12-14-23(6,7)8)21-20-17(5)15(3)16(4)19(10-2)22-20/h15-20H,9-11,13H2,1-8H3/t15-,16+,17?,18?,19?,20+/m0/s1 |
| InChIKey | CIILUZLNJXUUKM-AVTNHOIMSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|