C39H36IrN2O2-2 — CID 59386525
1,5-diphenylpentane-1,3-diol;iridium;bis(2-phenylpyridine) (PubChem CID 59386525) has the molecular formula C39H36IrN2O2-2 and a molecular weight of 756.95 g/mol. Its IUPAC name is 1,5-diphenylpentane-1,3-diol;iridium;bis(2-phenylpyridine).
| Compound Name | 1,5-diphenylpentane-1,3-diol;iridium;bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 59386525 |
| Molecular Formula | C39H36IrN2O2-2 |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 757.24 |
| IUPAC Name | 1,5-diphenylpentane-1,3-diol;iridium;bis(2-phenylpyridine) |
| SMILES | OC(CCc1ccccc1)CC(O)c1ccccc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C17H20O2.2C11H8N.Ir/c18-16(12-11-14-7-3-1-4-8-14)13-17(19)15-9-5-2-6-10-15;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-10,16-19H,11-13H2;2*1-6,8-9H;/q;2*-1; |
| InChIKey | YHKKEIXGDOPFCV-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|