C20H18FIN4OS — CID 59386795
3-[5-[(4S,5R)-2-amino-1,4-dimethyl-6-oxo-5-prop-2-enyl-5H-pyrimidin-4-yl]-2-iodothiophen-3-yl]-5-fluorobenzonitrile (PubChem CID 59386795) has the molecular formula C20H18FIN4OS and a molecular weight of 508.36 g/mol. Its IUPAC name is 3-[5-[(4S,5R)-2-amino-1,4-dimethyl-6-oxo-5-prop-2-enyl-5H-pyrimidin-4-yl]-2-iodothiophen-3-yl]-5-fluorobenzonitrile.
| Compound Name | 3-[5-[(4S,5R)-2-amino-1,4-dimethyl-6-oxo-5-prop-2-enyl-5H-pyrimidin-4-yl]-2-iodothiophen-3-yl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 59386795 |
| Molecular Formula | C20H18FIN4OS |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 3-[5-[(4S,5R)-2-amino-1,4-dimethyl-6-oxo-5-prop-2-enyl-5H-pyrimidin-4-yl]-2-iodothiophen-3-yl]-5-fluorobenzonitrile |
| SMILES | C=CC[C@H]1C(=O)N(C)C(N)=N[C@]1(C)c1cc(-c2cc(F)cc(C#N)c2)c(I)s1 |
| InChI | InChI=1S/C20H18FIN4OS/c1-4-5-15-18(27)26(3)19(24)25-20(15,2)16-9-14(17(22)28-16)12-6-11(10-23)7-13(21)8-12/h4,6-9,15H,1,5H2,2-3H3,(H2,24,25)/t15-,20-/m0/s1 |
| InChIKey | UPMHQAYFYMYXHC-YWZLYKJASA-N |
| XLogP | 4.22 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|