About 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one
2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one (PubChem CID 59387095) has the molecular formula C27H23N3OS
and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one.
Molecular Properties
| Compound Name | 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one |
| PubChem CID | 59387095 |
| Molecular Formula | C27H23N3OS |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one |
| SMILES | Cc1csc(-c2cccc(CN3C(=O)C(c4ccccc4)(c4ccccc4)N=C3N)c2)c1 |
| InChI | InChI=1S/C27H23N3OS/c1-19-15-24(32-18-19)21-10-8-9-20(16-21)17-30-25(31)27(29-26(30)28,22-11-4-2-5-12-22)23-13-6-3-7-14-23/h2-16,18H,17H2,1H3,(H2,28,29) |
| InChIKey | KUIOLZPNZZHEGE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
The IUPAC name of 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one (CID 59387095) is 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one.
What is the SMILES notation for 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
The canonical SMILES for 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one is Cc1csc(-c2cccc(CN3C(=O)C(c4ccccc4)(c4ccccc4)N=C3N)c2)c1.
What is the InChIKey of 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
The InChIKey is KUIOLZPNZZHEGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23N3OS/c1-19-15-24(32-18-19)21-10-8-9-20(16-21)17-30-25(31)27(29-26(30)28,22-11-4-2-5-12-22)23-13-6-3-7-14-23/h2-16,18H,17H2,1H3,(H2,28,29).
What are the key properties of 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one has a molecular weight of 437.57 g/mol, XLogP of 5.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[[3-(4-methylthiophen-2-yl)phenyl]methyl]-5,5-diphenylimidazol-4-one is sourced from PubChem (CID 59387095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).