About 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile
3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile (PubChem CID 59387179) has the molecular formula C29H22N4O
and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile |
| PubChem CID | 59387179 |
| Molecular Formula | C29H22N4O |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cccc(CN3C(=O)C(c4ccccc4)(c4ccccc4)N=C3N)c2)c1 |
| InChI | InChI=1S/C29H22N4O/c30-19-21-9-7-11-23(17-21)24-12-8-10-22(18-24)20-33-27(34)29(32-28(33)31,25-13-3-1-4-14-25)26-15-5-2-6-16-26/h1-18H,20H2,(H2,31,32) |
| InChIKey | ROMWOSHKXBEINS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile?
The IUPAC name of 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile (CID 59387179) is 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile.
What is the SMILES notation for 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile?
The canonical SMILES for 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile is N#Cc1cccc(-c2cccc(CN3C(=O)C(c4ccccc4)(c4ccccc4)N=C3N)c2)c1.
What is the InChIKey of 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile?
The InChIKey is ROMWOSHKXBEINS-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22N4O/c30-19-21-9-7-11-23(17-21)24-12-8-10-22(18-24)20-33-27(34)29(32-28(33)31,25-13-3-1-4-14-25)26-15-5-2-6-16-26/h1-18H,20H2,(H2,31,32).
What are the key properties of 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile?
3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile has a molecular weight of 442.52 g/mol, XLogP of 4.83, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(2-amino-5-oxo-4,4-diphenylimidazol-1-yl)methyl]phenyl]benzonitrile is sourced from PubChem (CID 59387179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).