C18H14BrN5OS — CID 59387301
5-[5-[(4R)-2-amino-5-bromo-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]thiophen-3-yl]benzene-1,3-dicarbonitrile (PubChem CID 59387301) has the molecular formula C18H14BrN5OS and a molecular weight of 428.32 g/mol. Its IUPAC name is 5-[5-[(4R)-2-amino-5-bromo-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]thiophen-3-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[5-[(4R)-2-amino-5-bromo-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]thiophen-3-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 59387301 |
| Molecular Formula | C18H14BrN5OS |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | 5-[5-[(4R)-2-amino-5-bromo-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]thiophen-3-yl]benzene-1,3-dicarbonitrile |
| SMILES | CN1C(=O)C(Br)[C@@](C)(c2cc(-c3cc(C#N)cc(C#N)c3)cs2)N=C1N |
| InChI | InChI=1S/C18H14BrN5OS/c1-18(15(19)16(25)24(2)17(22)23-18)14-6-13(9-26-14)12-4-10(7-20)3-11(5-12)8-21/h3-6,9,15H,1-2H3,(H2,22,23)/t15?,18-/m1/s1 |
| InChIKey | KKKRLZYHEFNTBY-KPMSDPLLSA-N |
| XLogP | 2.92 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|