C23H24ClN3O2 — CID 59387465
2-amino-5-[3-(3-chlorophenyl)phenyl]-5-cyclopropyl-3-(oxan-4-yl)imidazol-4-one (PubChem CID 59387465) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 2-amino-5-[3-(3-chlorophenyl)phenyl]-5-cyclopropyl-3-(oxan-4-yl)imidazol-4-one.
| Compound Name | 2-amino-5-[3-(3-chlorophenyl)phenyl]-5-cyclopropyl-3-(oxan-4-yl)imidazol-4-one |
|---|---|
| PubChem CID | 59387465 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-amino-5-[3-(3-chlorophenyl)phenyl]-5-cyclopropyl-3-(oxan-4-yl)imidazol-4-one |
| SMILES | NC1=NC(c2cccc(-c3cccc(Cl)c3)c2)(C2CC2)C(=O)N1C1CCOCC1 |
| InChI | InChI=1S/C23H24ClN3O2/c24-19-6-2-4-16(14-19)15-3-1-5-18(13-15)23(17-7-8-17)21(28)27(22(25)26-23)20-9-11-29-12-10-20/h1-6,13-14,17,20H,7-12H2,(H2,25,26) |
| InChIKey | VOKQZQGUDKOUBE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |