About 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one
2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one (PubChem CID 59388822) has the molecular formula C27H21ClN4O
and a molecular weight of 452.95 g/mol. Its IUPAC name is 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one.
Molecular Properties
| Compound Name | 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one |
| PubChem CID | 59388822 |
| Molecular Formula | C27H21ClN4O |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1cccc(-c2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C27H21ClN4O/c28-24-15-14-21(17-30-24)20-9-7-8-19(16-20)18-32-25(33)27(31-26(32)29,22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-17H,18H2,(H2,29,31) |
| InChIKey | MTVXALVLFIQUCG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
The IUPAC name of 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one (CID 59388822) is 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one.
What is the SMILES notation for 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
The canonical SMILES for 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one is NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1cccc(-c2ccc(Cl)nc2)c1.
What is the InChIKey of 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
The InChIKey is MTVXALVLFIQUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21ClN4O/c28-24-15-14-21(17-30-24)20-9-7-8-19(16-20)18-32-25(33)27(31-26(32)29,22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-17H,18H2,(H2,29,31).
What are the key properties of 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one?
2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one has a molecular weight of 452.95 g/mol, XLogP of 5.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[[3-(6-chloro-3-pyridinyl)phenyl]methyl]-5,5-diphenylimidazol-4-one is sourced from PubChem (CID 59388822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).