About (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one
(6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one (PubChem CID 59388911) has the molecular formula C22H26N4O
and a molecular weight of 362.48 g/mol. Its IUPAC name is (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one.
Molecular Properties
| Compound Name | (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one |
| PubChem CID | 59388911 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one |
| SMILES | CN1C(=O)C[C@@](C)(c2cccc(-c3cccc(N4CCCC4)c3)c2)N=C1N |
| InChI | InChI=1S/C22H26N4O/c1-22(15-20(27)25(2)21(23)24-22)18-9-5-7-16(13-18)17-8-6-10-19(14-17)26-11-3-4-12-26/h5-10,13-14H,3-4,11-12,15H2,1-2H3,(H2,23,24)/t22-/m0/s1 |
| InChIKey | UMZNCFXTZZFFNQ-QFIPXVFZSA-N |
| XLogP | 3.35 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one?
The IUPAC name of (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one (CID 59388911) is (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one.
What is the SMILES notation for (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one?
The canonical SMILES for (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one is CN1C(=O)C[C@@](C)(c2cccc(-c3cccc(N4CCCC4)c3)c2)N=C1N.
What is the InChIKey of (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one?
The InChIKey is UMZNCFXTZZFFNQ-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H26N4O/c1-22(15-20(27)25(2)21(23)24-22)18-9-5-7-16(13-18)17-8-6-10-19(14-17)26-11-3-4-12-26/h5-10,13-14H,3-4,11-12,15H2,1-2H3,(H2,23,24)/t22-/m0/s1.
What are the key properties of (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one?
(6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one has a molecular weight of 362.48 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2-amino-3,6-dimethyl-6-[3-(3-pyrrolidin-1-ylphenyl)phenyl]-5H-pyrimidin-4-one is sourced from PubChem (CID 59388911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).