About tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate
tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate (PubChem CID 59389214) has the molecular formula C18H26F2N2O2
and a molecular weight of 340.41 g/mol. Its IUPAC name is tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate |
| PubChem CID | 59389214 |
| Molecular Formula | C18H26F2N2O2 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate |
| SMILES | C=CCNC(CN(CC)C(=O)OC(C)(C)C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H26F2N2O2/c1-6-8-21-16(13-9-14(19)11-15(20)10-13)12-22(7-2)17(23)24-18(3,4)5/h6,9-11,16,21H,1,7-8,12H2,2-5H3 |
| InChIKey | GXWNBEUNNOYIBY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate?
The IUPAC name of tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate (CID 59389214) is tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate.
What is the SMILES notation for tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate?
The canonical SMILES for tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate is C=CCNC(CN(CC)C(=O)OC(C)(C)C)c1cc(F)cc(F)c1.
What is the InChIKey of tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate?
The InChIKey is GXWNBEUNNOYIBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F2N2O2/c1-6-8-21-16(13-9-14(19)11-15(20)10-13)12-22(7-2)17(23)24-18(3,4)5/h6,9-11,16,21H,1,7-8,12H2,2-5H3.
What are the key properties of tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate?
tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate has a molecular weight of 340.41 g/mol, XLogP of 4.04, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate is sourced from PubChem (CID 59389214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).