C18H26F2N2O2 — CID 59389214
tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate (PubChem CID 59389214) has the molecular formula C18H26F2N2O2 and a molecular weight of 340.41 g/mol. Its IUPAC name is tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 59389214 |
| Molecular Formula | C18H26F2N2O2 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | tert-butyl N-[2-(3,5-difluorophenyl)-2-(prop-2-enylamino)ethyl]-N-ethylcarbamate |
| SMILES | C=CCNC(CN(CC)C(=O)OC(C)(C)C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H26F2N2O2/c1-6-8-21-16(13-9-14(19)11-15(20)10-13)12-22(7-2)17(23)24-18(3,4)5/h6,9-11,16,21H,1,7-8,12H2,2-5H3 |
| InChIKey | GXWNBEUNNOYIBY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|