About 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate
4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate (PubChem CID 59389230) has the molecular formula C14H23NO5
and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate |
| PubChem CID | 59389230 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate |
| SMILES | C=CC[C@@H]1COC[C@H](C(=O)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO5/c1-6-7-10-8-19-9-11(12(16)18-5)15(10)13(17)20-14(2,3)4/h6,10-11H,1,7-9H2,2-5H3/t10-,11-/m1/s1 |
| InChIKey | PTGIECWPMAXWPL-GHMZBOCLSA-N |
| XLogP | 1.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate?
The IUPAC name of 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate (CID 59389230) is 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate.
What is the SMILES notation for 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate?
The canonical SMILES for 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate is C=CC[C@@H]1COC[C@H](C(=O)OC)N1C(=O)OC(C)(C)C.
What is the InChIKey of 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate?
The InChIKey is PTGIECWPMAXWPL-GHMZBOCLSA-N. The full InChI is InChI=1S/C14H23NO5/c1-6-7-10-8-19-9-11(12(16)18-5)15(10)13(17)20-14(2,3)4/h6,10-11H,1,7-9H2,2-5H3/t10-,11-/m1/s1.
What are the key properties of 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate?
4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate has a molecular weight of 285.34 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 3-O-methyl (3R,5R)-5-prop-2-enylmorpholine-3,4-dicarboxylate is sourced from PubChem (CID 59389230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).