About (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate
(2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate (PubChem CID 59389277) has the molecular formula C10H8F4N2O3S
and a molecular weight of 312.24 g/mol. Its IUPAC name is (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate |
| PubChem CID | 59389277 |
| Molecular Formula | C10H8F4N2O3S |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate |
| SMILES | CCc1cc2c(OS(=O)(=O)C(F)(F)F)cc(F)cn2n1 |
| InChI | InChI=1S/C10H8F4N2O3S/c1-2-7-4-8-9(3-6(11)5-16(8)15-7)19-20(17,18)10(12,13)14/h3-5H,2H2,1H3 |
| InChIKey | JBBZYRYRGDAQRA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate?
The IUPAC name of (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate (CID 59389277) is (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate is CCc1cc2c(OS(=O)(=O)C(F)(F)F)cc(F)cn2n1.
What is the InChIKey of (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate?
The InChIKey is JBBZYRYRGDAQRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F4N2O3S/c1-2-7-4-8-9(3-6(11)5-16(8)15-7)19-20(17,18)10(12,13)14/h3-5H,2H2,1H3.
What are the key properties of (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate?
(2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate has a molecular weight of 312.24 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-6-fluoropyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 59389277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).