C10H8F3IN2 — CID 59389393
4-ethyl-7-iodo-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine (PubChem CID 59389393) has the molecular formula C10H8F3IN2 and a molecular weight of 340.09 g/mol. Its IUPAC name is 4-ethyl-7-iodo-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine.
| Compound Name | 4-ethyl-7-iodo-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 59389393 |
| Molecular Formula | C10H8F3IN2 |
| Molecular Weight | 340.09 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 4-ethyl-7-iodo-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine |
| SMILES | CCc1ccc(I)n2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C10H8F3IN2/c1-2-6-3-4-9(14)16-7(6)5-8(15-16)10(11,12)13/h3-5H,2H2,1H3 |
| InChIKey | OGCMJSWEPMDPES-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.09 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|