C20H23F2N3O4 — CID 59389431
5-(2-cyclopentylethyl)-2-[(4,4-difluorocyclohexylidene)amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 59389431) has the molecular formula C20H23F2N3O4 and a molecular weight of 407.42 g/mol. Its IUPAC name is 5-(2-cyclopentylethyl)-2-[(4,4-difluorocyclohexylidene)amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-cyclopentylethyl)-2-[(4,4-difluorocyclohexylidene)amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59389431 |
| Molecular Formula | C20H23F2N3O4 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 5-(2-cyclopentylethyl)-2-[(4,4-difluorocyclohexylidene)amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=c1cc(CCC2CCCC2)c2c(=O)[nH]c(ON=C3CCC(F)(F)CC3)nc2o1 |
| InChI | InChI=1S/C20H23F2N3O4/c21-20(22)9-7-14(8-10-20)25-29-19-23-17(27)16-13(6-5-12-3-1-2-4-12)11-15(26)28-18(16)24-19/h11-12H,1-10H2,(H,23,24,27) |
| InChIKey | QSNPANSCLWRJBS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|