C20H18FN3O4 — CID 59389534
2-(cyclohexylideneamino)oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 59389534) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-(cyclohexylideneamino)oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-(cyclohexylideneamino)oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59389534 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(cyclohexylideneamino)oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=c1cc(Cc2cccc(F)c2)c2c(=O)[nH]c(ON=C3CCCCC3)nc2o1 |
| InChI | InChI=1S/C20H18FN3O4/c21-14-6-4-5-12(10-14)9-13-11-16(25)27-19-17(13)18(26)22-20(23-19)28-24-15-7-2-1-3-8-15/h4-6,10-11H,1-3,7-9H2,(H,22,23,26) |
| InChIKey | RKFWVYAGBMODCP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|