C21H19FN4O5 — CID 59389565
2-[(1-acetylpiperidin-4-ylidene)amino]oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 59389565) has the molecular formula C21H19FN4O5 and a molecular weight of 426.40 g/mol. Its IUPAC name is 2-[(1-acetylpiperidin-4-ylidene)amino]oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-[(1-acetylpiperidin-4-ylidene)amino]oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 59389565 |
| Molecular Formula | C21H19FN4O5 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-[(1-acetylpiperidin-4-ylidene)amino]oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CC(=O)N1CCC(=NOc2nc3oc(=O)cc(Cc4cccc(F)c4)c3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C21H19FN4O5/c1-12(27)26-7-5-16(6-8-26)25-31-21-23-19(29)18-14(11-17(28)30-20(18)24-21)9-13-3-2-4-15(22)10-13/h2-4,10-11H,5-9H2,1H3,(H,23,24,29) |
| InChIKey | XTFILKQHQFVIAI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|