C14H12F17IO — CID 59389715
7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-5-iodotetradecan-1-ol (PubChem CID 59389715) has the molecular formula C14H12F17IO and a molecular weight of 646.12 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-5-iodotetradecan-1-ol.
| Compound Name | 7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-5-iodotetradecan-1-ol |
|---|---|
| PubChem CID | 59389715 |
| Molecular Formula | C14H12F17IO |
| Molecular Weight | 646.12 g/mol |
| Exact Mass | 645.97 |
| IUPAC Name | 7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptadecafluoro-5-iodotetradecan-1-ol |
| SMILES | OCCCCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F17IO/c15-7(16,5-6(32)3-1-2-4-33)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h6,33H,1-5H2 |
| InChIKey | LMORFZPQITYBGJ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.12 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|