C44H58N3O3+ — CID 59389716
[6-(1-hexylpyridin-1-ium-4-yl)-2-phenyl-4-pyridin-4-yl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhexyl] benzoate (PubChem CID 59389716) has the molecular formula C44H58N3O3+ and a molecular weight of 676.97 g/mol. Its IUPAC name is [6-(1-hexylpyridin-1-ium-4-yl)-2-phenyl-4-pyridin-4-yl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhexyl] benzoate.
| Compound Name | [6-(1-hexylpyridin-1-ium-4-yl)-2-phenyl-4-pyridin-4-yl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhexyl] benzoate |
|---|---|
| PubChem CID | 59389716 |
| Molecular Formula | C44H58N3O3+ |
| Molecular Weight | 676.97 g/mol |
| Exact Mass | 676.45 |
| IUPAC Name | [6-(1-hexylpyridin-1-ium-4-yl)-2-phenyl-4-pyridin-4-yl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhexyl] benzoate |
| SMILES | CCCCCC[n+]1ccc(C(CC(CC(COC(=O)c2ccccc2)c2ccccc2)c2ccncc2)ON2C(C)(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C44H58N3O3/c1-6-7-8-15-29-46-30-23-37(24-31-46)41(50-47-43(2,3)25-16-26-44(47,4)5)33-39(36-21-27-45-28-22-36)32-40(35-17-11-9-12-18-35)34-49-42(48)38-19-13-10-14-20-38/h9-14,17-24,27-28,30-31,39-41H,6-8,15-16,25-26,29,32-34H2,1-5H3/q+1 |
| InChIKey | UBFJWWHNHOMFGS-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.97 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|