About 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine
2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine (PubChem CID 59390095) has the molecular formula C16H29N
and a molecular weight of 235.41 g/mol. Its IUPAC name is 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine.
Molecular Properties
| Compound Name | 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine |
| PubChem CID | 59390095 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine |
| SMILES | CC1=C(C2CCCN2C)C(C(C)C)CC[C@H]1C |
| InChI | InChI=1S/C16H29N/c1-11(2)14-9-8-12(3)13(4)16(14)15-7-6-10-17(15)5/h11-12,14-15H,6-10H2,1-5H3/t12-,14?,15?/m1/s1 |
| InChIKey | WMEFQQRHCFVRBQ-LRVUVFPRSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine?
The IUPAC name of 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine (CID 59390095) is 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine.
What is the SMILES notation for 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine?
The canonical SMILES for 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine is CC1=C(C2CCCN2C)C(C(C)C)CC[C@H]1C.
What is the InChIKey of 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine?
The InChIKey is WMEFQQRHCFVRBQ-LRVUVFPRSA-N. The full InChI is InChI=1S/C16H29N/c1-11(2)14-9-8-12(3)13(4)16(14)15-7-6-10-17(15)5/h11-12,14-15H,6-10H2,1-5H3/t12-,14?,15?/m1/s1.
What are the key properties of 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine?
2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine has a molecular weight of 235.41 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-2,3-dimethyl-6-propan-2-ylcyclohexen-1-yl]-1-methylpyrrolidine is sourced from PubChem (CID 59390095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).