C16H26S — CID 59390138
3-methyl-4-[(1S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]thiane (PubChem CID 59390138) has the molecular formula C16H26S and a molecular weight of 250.45 g/mol. Its IUPAC name is 3-methyl-4-[(1S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]thiane.
| Compound Name | 3-methyl-4-[(1S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]thiane |
|---|---|
| PubChem CID | 59390138 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 3-methyl-4-[(1S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]thiane |
| SMILES | CC1=C(C2CCSCC2C)[C@H]2C[C@@H](C1)C2(C)C |
| InChI | InChI=1S/C16H26S/c1-10-7-12-8-14(16(12,3)4)15(10)13-5-6-17-9-11(13)2/h11-14H,5-9H2,1-4H3/t11?,12-,13?,14-/m1/s1 |
| InChIKey | DMJWWWJBDCOSMK-FKZOYECMSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|