About 2,4-dimethylselenophene
2,4-dimethylselenophene (PubChem CID 59390251) has the molecular formula C6H8Se
and a molecular weight of 159.09 g/mol. Its IUPAC name is 2,4-dimethylselenophene.
Molecular Properties
| Compound Name | 2,4-dimethylselenophene |
| PubChem CID | 59390251 |
| Molecular Formula | C6H8Se |
| Molecular Weight | 159.09 g/mol |
| Exact Mass | 159.98 |
| IUPAC Name | 2,4-dimethylselenophene |
| SMILES | Cc1c[se]c(C)c1 |
| InChI | InChI=1S/C6H8Se/c1-5-3-6(2)7-4-5/h3-4H,1-2H3 |
| InChIKey | QWXTUFCYROZGIV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.09 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylselenophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylselenophene?
The IUPAC name of 2,4-dimethylselenophene (CID 59390251) is 2,4-dimethylselenophene.
What is the SMILES notation for 2,4-dimethylselenophene?
The canonical SMILES for 2,4-dimethylselenophene is Cc1c[se]c(C)c1.
What is the InChIKey of 2,4-dimethylselenophene?
The InChIKey is QWXTUFCYROZGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Se/c1-5-3-6(2)7-4-5/h3-4H,1-2H3.
What are the key properties of 2,4-dimethylselenophene?
2,4-dimethylselenophene has a molecular weight of 159.09 g/mol, XLogP of 1.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylselenophene is sourced from PubChem (CID 59390251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).