About carbanide;4-methylpent-1-ene;tridecakis(yttrium)
carbanide;4-methylpent-1-ene;tridecakis(yttrium) (PubChem CID 59390262) has the molecular formula C7H14Y13-2
and a molecular weight of 1253.97 g/mol. Its IUPAC name is carbanide;4-methylpent-1-ene;tridecakis(yttrium).
Molecular Properties
| Compound Name | carbanide;4-methylpent-1-ene;tridecakis(yttrium) |
| PubChem CID | 59390262 |
| Molecular Formula | C7H14Y13-2 |
| Molecular Weight | 1253.97 g/mol |
| Exact Mass | 1253.89 |
| IUPAC Name | carbanide;4-methylpent-1-ene;tridecakis(yttrium) |
| SMILES | C=[C-]CC(C)C.[CH3-].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C6H11.CH3.13Y/c1-4-5-6(2)3;;;;;;;;;;;;;;/h6H,1,5H2,2-3H3;1H3;;;;;;;;;;;;;/q2*-1;;;;;;;;;;;;; |
| InChIKey | XYCWQTCOGKDWSJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1253.97 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;4-methylpent-1-ene;tridecakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;4-methylpent-1-ene;tridecakis(yttrium)?
The IUPAC name of carbanide;4-methylpent-1-ene;tridecakis(yttrium) (CID 59390262) is carbanide;4-methylpent-1-ene;tridecakis(yttrium).
What is the SMILES notation for carbanide;4-methylpent-1-ene;tridecakis(yttrium)?
The canonical SMILES for carbanide;4-methylpent-1-ene;tridecakis(yttrium) is C=[C-]CC(C)C.[CH3-].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of carbanide;4-methylpent-1-ene;tridecakis(yttrium)?
The InChIKey is XYCWQTCOGKDWSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11.CH3.13Y/c1-4-5-6(2)3;;;;;;;;;;;;;;/h6H,1,5H2,2-3H3;1H3;;;;;;;;;;;;;/q2*-1;;;;;;;;;;;;;.
What are the key properties of carbanide;4-methylpent-1-ene;tridecakis(yttrium)?
carbanide;4-methylpent-1-ene;tridecakis(yttrium) has a molecular weight of 1253.97 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;4-methylpent-1-ene;tridecakis(yttrium) is sourced from PubChem (CID 59390262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).