C11H10N2O2 — CID 593912
3-(1-methylbenzimidazol-2-yl)prop-2-enoic acid (PubChem CID 593912) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-(1-methylbenzimidazol-2-yl)prop-2-enoic acid.
| Compound Name | 3-(1-methylbenzimidazol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 593912 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-(1-methylbenzimidazol-2-yl)prop-2-enoic acid |
| SMILES | Cn1c(C=CC(=O)O)nc2ccccc21 |
| InChI | InChI=1S/C11H10N2O2/c1-13-9-5-3-2-4-8(9)12-10(13)6-7-11(14)15/h2-7H,1H3,(H,14,15) |
| InChIKey | MFJCQRHGLKEFEG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|