C31H54O16S — CID 59391705
[2-[4,5-dihydroxy-6-(hydroxymethyl)-3-(trioxidanylsulfanyloxy)oxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-octanoyloxyoxan-4-yl] (E,4S,6S)-2,4,6-trimethyloct-2-enoate (PubChem CID 59391705) has the molecular formula C31H54O16S and a molecular weight of 714.82 g/mol. Its IUPAC name is [2-[4,5-dihydroxy-6-(hydroxymethyl)-3-(trioxidanylsulfanyloxy)oxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-octanoyloxyoxan-4-yl] (E,4S,6S)-2,4,6-trimethyloct-2-enoate.
| Compound Name | [2-[4,5-dihydroxy-6-(hydroxymethyl)-3-(trioxidanylsulfanyloxy)oxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-octanoyloxyoxan-4-yl] (E,4S,6S)-2,4,6-trimethyloct-2-enoate |
|---|---|
| PubChem CID | 59391705 |
| Molecular Formula | C31H54O16S |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 714.31 |
| IUPAC Name | [2-[4,5-dihydroxy-6-(hydroxymethyl)-3-(trioxidanylsulfanyloxy)oxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-octanoyloxyoxan-4-yl] (E,4S,6S)-2,4,6-trimethyloct-2-enoate |
| SMILES | CCCCCCCC(=O)OC1C(OC2OC(CO)C(O)C(O)C2OSOOO)OC(CO)C(O)C1OC(=O)/C(C)=C/[C@@H](C)C[C@@H](C)CC |
| InChI | InChI=1S/C31H54O16S/c1-6-8-9-10-11-12-22(34)42-28-26(43-29(38)19(5)14-18(4)13-17(3)7-2)24(36)21(16-33)41-31(28)44-30-27(45-48-47-46-39)25(37)23(35)20(15-32)40-30/h14,17-18,20-21,23-28,30-33,35-37,39H,6-13,15-16H2,1-5H3/b19-14+/t17-,18-,20?,21?,23?,24?,25?,26?,27?,28?,30?,31?/m0/s1 |
| InChIKey | ZDJVGXWSXLLONZ-CXQJVJGYSA-N |
| XLogP | 2.09 |
| TPSA | 229.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|