C36H35ClF3N3O10 — CID 59391891
4-nitrooxybutyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[2-(2,4,6-trifluorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 59391891) has the molecular formula C36H35ClF3N3O10 and a molecular weight of 762.13 g/mol. Its IUPAC name is 4-nitrooxybutyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[2-(2,4,6-trifluorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 4-nitrooxybutyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[2-(2,4,6-trifluorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 59391891 |
| Molecular Formula | C36H35ClF3N3O10 |
| Molecular Weight | 762.13 g/mol |
| Exact Mass | 761.20 |
| IUPAC Name | 4-nitrooxybutyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[2-(2,4,6-trifluorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | O=C(OCCCCO[N+](=O)[O-])N1CCC(c2ccc(OCCOc3c(F)cc(F)cc3F)cc2)=C(C(=O)N(Cc2cc3c(cc2Cl)OCO3)C2CC2)C1 |
| InChI | InChI=1S/C36H35ClF3N3O10/c37-29-18-33-32(51-21-52-33)15-23(29)19-42(25-5-6-25)35(44)28-20-41(36(45)50-11-1-2-12-53-43(46)47)10-9-27(28)22-3-7-26(8-4-22)48-13-14-49-34-30(39)16-24(38)17-31(34)40/h3-4,7-8,15-18,25H,1-2,5-6,9-14,19-21H2 |
| InChIKey | SGYFQZLZNATZGC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 139.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.13 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|