C36H35ClF3N3O11 — CID 59391904
2-(2-nitrooxyethoxy)ethyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[2-(2,4,6-trifluorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 59391904) has the molecular formula C36H35ClF3N3O11 and a molecular weight of 778.13 g/mol. Its IUPAC name is 2-(2-nitrooxyethoxy)ethyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[2-(2,4,6-trifluorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 2-(2-nitrooxyethoxy)ethyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[2-(2,4,6-trifluorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 59391904 |
| Molecular Formula | C36H35ClF3N3O11 |
| Molecular Weight | 778.13 g/mol |
| Exact Mass | 777.19 |
| IUPAC Name | 2-(2-nitrooxyethoxy)ethyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[2-(2,4,6-trifluorophenoxy)ethoxy]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | O=C(OCCOCCO[N+](=O)[O-])N1CCC(c2ccc(OCCOc3c(F)cc(F)cc3F)cc2)=C(C(=O)N(Cc2cc3c(cc2Cl)OCO3)C2CC2)C1 |
| InChI | InChI=1S/C36H35ClF3N3O11/c37-29-18-33-32(52-21-53-33)15-23(29)19-42(25-3-4-25)35(44)28-20-41(36(45)51-11-9-48-10-14-54-43(46)47)8-7-27(28)22-1-5-26(6-2-22)49-12-13-50-34-30(39)16-24(38)17-31(34)40/h1-2,5-6,15-18,25H,3-4,7-14,19-21H2 |
| InChIKey | UVAOCHYVQVSNQB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 148.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.13 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|