C37H37ClF3N3O9 — CID 59391948
4-nitrooxybutyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 59391948) has the molecular formula C37H37ClF3N3O9 and a molecular weight of 760.16 g/mol. Its IUPAC name is 4-nitrooxybutyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 4-nitrooxybutyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 59391948 |
| Molecular Formula | C37H37ClF3N3O9 |
| Molecular Weight | 760.16 g/mol |
| Exact Mass | 759.22 |
| IUPAC Name | 4-nitrooxybutyl 5-[(6-chloro-1,3-benzodioxol-5-yl)methyl-cyclopropylcarbamoyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | O=C(OCCCCO[N+](=O)[O-])N1CCC(c2ccc(CCCOc3c(F)ccc(F)c3F)cc2)=C(C(=O)N(Cc2cc3c(cc2Cl)OCO3)C2CC2)C1 |
| InChI | InChI=1S/C37H37ClF3N3O9/c38-29-19-33-32(51-22-52-33)18-25(29)20-43(26-9-10-26)36(45)28-21-42(37(46)50-15-1-2-17-53-44(47)48)14-13-27(28)24-7-5-23(6-8-24)4-3-16-49-35-31(40)12-11-30(39)34(35)41/h5-8,11-12,18-19,26H,1-4,9-10,13-17,20-22H2 |
| InChIKey | WEOBYJAWIAAJCF-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 129.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.16 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|