C21H21N3O5 — CID 59392421
6-benzyl-5,6,8-trimethyl-2-(2-nitrophenyl)-1-oxa-5,8-diazaspiro[2.5]octane-4,7-dione (PubChem CID 59392421) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 6-benzyl-5,6,8-trimethyl-2-(2-nitrophenyl)-1-oxa-5,8-diazaspiro[2.5]octane-4,7-dione.
| Compound Name | 6-benzyl-5,6,8-trimethyl-2-(2-nitrophenyl)-1-oxa-5,8-diazaspiro[2.5]octane-4,7-dione |
|---|---|
| PubChem CID | 59392421 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 6-benzyl-5,6,8-trimethyl-2-(2-nitrophenyl)-1-oxa-5,8-diazaspiro[2.5]octane-4,7-dione |
| SMILES | CN1C(=O)C2(OC2c2ccccc2[N+](=O)[O-])N(C)C(=O)C1(C)Cc1ccccc1 |
| InChI | InChI=1S/C21H21N3O5/c1-20(13-14-9-5-4-6-10-14)18(25)23(3)21(19(26)22(20)2)17(29-21)15-11-7-8-12-16(15)24(27)28/h4-12,17H,13H2,1-3H3 |
| InChIKey | MPLJMZMUTMTUOG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|