C37H56O3 — CID 59392555
[3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-4,4-dimethylcyclohex-2-en-1-yl] (9E,12E)-octadeca-9,12-dienoate (PubChem CID 59392555) has the molecular formula C37H56O3 and a molecular weight of 548.85 g/mol. Its IUPAC name is [3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-4,4-dimethylcyclohex-2-en-1-yl] (9E,12E)-octadeca-9,12-dienoate.
| Compound Name | [3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-4,4-dimethylcyclohex-2-en-1-yl] (9E,12E)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 59392555 |
| Molecular Formula | C37H56O3 |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.42 |
| IUPAC Name | [3-[(1E,3E,5E,7E)-3,7-dimethyl-9-oxonona-1,3,5,7-tetraenyl]-4,4-dimethylcyclohex-2-en-1-yl] (9E,12E)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC1C=C(/C=C/C(C)=C/C=C/C(C)=C/C=O)C(C)(C)CC1 |
| InChI | InChI=1S/C37H56O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-36(39)40-35-27-29-37(4,5)34(31-35)26-25-32(2)22-21-23-33(3)28-30-38/h10-11,13-14,21-23,25-26,28,30-31,35H,6-9,12,15-20,24,27,29H2,1-5H3/b11-10+,14-13+,23-21+,26-25+,32-22+,33-28+ |
| InChIKey | QSRPHOJCBXLDIG-XENFHTEZSA-N |
| XLogP | 10.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|