C18H23BF3NO4 — CID 59392704
morpholin-4-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methanone (PubChem CID 59392704) has the molecular formula C18H23BF3NO4 and a molecular weight of 385.19 g/mol. Its IUPAC name is morpholin-4-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methanone.
| Compound Name | morpholin-4-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 59392704 |
| Molecular Formula | C18H23BF3NO4 |
| Molecular Weight | 385.19 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | morpholin-4-yl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1(C)OB(c2ccc(C(=O)N3CCOCC3)c(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C18H23BF3NO4/c1-16(2)17(3,4)27-19(26-16)12-5-6-13(14(11-12)18(20,21)22)15(24)23-7-9-25-10-8-23/h5-6,11H,7-10H2,1-4H3 |
| InChIKey | DTYCNSLSLXIRTL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|