C27H27F3N4O3S — CID 59393665
[6-[1-[4-[2-(2,5-dimethylpyrrol-1-yl)pyrimidin-5-yl]phenyl]-2,2-dimethylpropyl]-3-pyridinyl] trifluoromethanesulfonate (PubChem CID 59393665) has the molecular formula C27H27F3N4O3S and a molecular weight of 544.60 g/mol. Its IUPAC name is [6-[1-[4-[2-(2,5-dimethylpyrrol-1-yl)pyrimidin-5-yl]phenyl]-2,2-dimethylpropyl]-3-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [6-[1-[4-[2-(2,5-dimethylpyrrol-1-yl)pyrimidin-5-yl]phenyl]-2,2-dimethylpropyl]-3-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59393665 |
| Molecular Formula | C27H27F3N4O3S |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | [6-[1-[4-[2-(2,5-dimethylpyrrol-1-yl)pyrimidin-5-yl]phenyl]-2,2-dimethylpropyl]-3-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(C)n1-c1ncc(-c2ccc(C(c3ccc(OS(=O)(=O)C(F)(F)F)cn3)C(C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C27H27F3N4O3S/c1-17-6-7-18(2)34(17)25-32-14-21(15-33-25)19-8-10-20(11-9-19)24(26(3,4)5)23-13-12-22(16-31-23)37-38(35,36)27(28,29)30/h6-16,24H,1-5H3 |
| InChIKey | TXTYQBLIQONHGS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|