About 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid
4-thiophen-3-ylbenzene-1,3-dicarboxylic acid (PubChem CID 59395096) has the molecular formula C12H8O4S
and a molecular weight of 248.26 g/mol. Its IUPAC name is 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid |
| PubChem CID | 59395096 |
| Molecular Formula | C12H8O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccsc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H8O4S/c13-11(14)7-1-2-9(8-3-4-17-6-8)10(5-7)12(15)16/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | LMWXEMDVKCPDFE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid (CID 59395096) is 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid is O=C(O)c1ccc(-c2ccsc2)c(C(=O)O)c1.
What is the InChIKey of 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid?
The InChIKey is LMWXEMDVKCPDFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O4S/c13-11(14)7-1-2-9(8-3-4-17-6-8)10(5-7)12(15)16/h1-6H,(H,13,14)(H,15,16).
What are the key properties of 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid?
4-thiophen-3-ylbenzene-1,3-dicarboxylic acid has a molecular weight of 248.26 g/mol, XLogP of 2.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-3-ylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 59395096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).