C25H35N3 — CID 59395187
1-[(1-benzyl-4-phenylpiperidin-4-yl)methyl]-3,5-dimethylpiperazine (PubChem CID 59395187) has the molecular formula C25H35N3 and a molecular weight of 377.58 g/mol. Its IUPAC name is 1-[(1-benzyl-4-phenylpiperidin-4-yl)methyl]-3,5-dimethylpiperazine.
| Compound Name | 1-[(1-benzyl-4-phenylpiperidin-4-yl)methyl]-3,5-dimethylpiperazine |
|---|---|
| PubChem CID | 59395187 |
| Molecular Formula | C25H35N3 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 1-[(1-benzyl-4-phenylpiperidin-4-yl)methyl]-3,5-dimethylpiperazine |
| SMILES | CC1CN(CC2(c3ccccc3)CCN(Cc3ccccc3)CC2)CC(C)N1 |
| InChI | InChI=1S/C25H35N3/c1-21-17-28(18-22(2)26-21)20-25(24-11-7-4-8-12-24)13-15-27(16-14-25)19-23-9-5-3-6-10-23/h3-12,21-22,26H,13-20H2,1-2H3 |
| InChIKey | IDOMBCXMCWXCHM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |