C23H24ClN7O3 — CID 59395505
3-butyl-8-chloro-1-[4-[5-(1H-indol-6-yl)-1,2,4-oxadiazol-3-yl]butyl]-7H-purine-2,6-dione (PubChem CID 59395505) has the molecular formula C23H24ClN7O3 and a molecular weight of 481.94 g/mol. Its IUPAC name is 3-butyl-8-chloro-1-[4-[5-(1H-indol-6-yl)-1,2,4-oxadiazol-3-yl]butyl]-7H-purine-2,6-dione.
| Compound Name | 3-butyl-8-chloro-1-[4-[5-(1H-indol-6-yl)-1,2,4-oxadiazol-3-yl]butyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59395505 |
| Molecular Formula | C23H24ClN7O3 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 3-butyl-8-chloro-1-[4-[5-(1H-indol-6-yl)-1,2,4-oxadiazol-3-yl]butyl]-7H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)n(CCCCc2noc(-c3ccc4cc[nH]c4c3)n2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C23H24ClN7O3/c1-2-3-11-30-19-18(27-22(24)28-19)21(32)31(23(30)33)12-5-4-6-17-26-20(34-29-17)15-8-7-14-9-10-25-16(14)13-15/h7-10,13,25H,2-6,11-12H2,1H3,(H,27,28) |
| InChIKey | WWLQINBSDCSKAF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|