C27H33ClN6O3 — CID 59395565
3-butyl-8-chloro-1-[4-[5-(2-cyclohexylphenyl)-1,2,4-oxadiazol-3-yl]butyl]-7H-purine-2,6-dione (PubChem CID 59395565) has the molecular formula C27H33ClN6O3 and a molecular weight of 525.05 g/mol. Its IUPAC name is 3-butyl-8-chloro-1-[4-[5-(2-cyclohexylphenyl)-1,2,4-oxadiazol-3-yl]butyl]-7H-purine-2,6-dione.
| Compound Name | 3-butyl-8-chloro-1-[4-[5-(2-cyclohexylphenyl)-1,2,4-oxadiazol-3-yl]butyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59395565 |
| Molecular Formula | C27H33ClN6O3 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 3-butyl-8-chloro-1-[4-[5-(2-cyclohexylphenyl)-1,2,4-oxadiazol-3-yl]butyl]-7H-purine-2,6-dione |
| SMILES | CCCCn1c(=O)n(CCCCc2noc(-c3ccccc3C3CCCCC3)n2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C27H33ClN6O3/c1-2-3-16-33-23-22(30-26(28)31-23)25(35)34(27(33)36)17-10-9-15-21-29-24(37-32-21)20-14-8-7-13-19(20)18-11-5-4-6-12-18/h7-8,13-14,18H,2-6,9-12,15-17H2,1H3,(H,30,31) |
| InChIKey | NDNUGABPIVOVFE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|