C21H22ClF3N8O3 — CID 59395648
8-chloro-3-(2-ethoxyethyl)-1-[3-[5-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-2-yl]propyl]-7H-purine-2,6-dione (PubChem CID 59395648) has the molecular formula C21H22ClF3N8O3 and a molecular weight of 526.91 g/mol. Its IUPAC name is 8-chloro-3-(2-ethoxyethyl)-1-[3-[5-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-2-yl]propyl]-7H-purine-2,6-dione.
| Compound Name | 8-chloro-3-(2-ethoxyethyl)-1-[3-[5-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-2-yl]propyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 59395648 |
| Molecular Formula | C21H22ClF3N8O3 |
| Molecular Weight | 526.91 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 8-chloro-3-(2-ethoxyethyl)-1-[3-[5-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-2-yl]propyl]-7H-purine-2,6-dione |
| SMILES | CCOCCn1c(=O)n(CCCn2nnc(Cc3cccc(C(F)(F)F)c3)n2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C21H22ClF3N8O3/c1-2-36-10-9-31-17-16(26-19(22)27-17)18(34)32(20(31)35)7-4-8-33-29-15(28-30-33)12-13-5-3-6-14(11-13)21(23,24)25/h3,5-6,11H,2,4,7-10,12H2,1H3,(H,26,27) |
| InChIKey | BONIDKOYNJPKNE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.91 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|