About 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile
5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile (PubChem CID 59395706) has the molecular formula C15H20ClN5O2
and a molecular weight of 337.81 g/mol. Its IUPAC name is 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile.
Molecular Properties
| Compound Name | 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile |
| PubChem CID | 59395706 |
| Molecular Formula | C15H20ClN5O2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile |
| SMILES | CCCCCn1c(=O)n(CCCCC#N)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C15H20ClN5O2/c1-2-3-6-9-20-12-11(18-14(16)19-12)13(22)21(15(20)23)10-7-4-5-8-17/h2-7,9-10H2,1H3,(H,18,19) |
| InChIKey | NCXNEFKJJQAIOQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile?
The IUPAC name of 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile (CID 59395706) is 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile.
What is the SMILES notation for 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile?
The canonical SMILES for 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile is CCCCCn1c(=O)n(CCCCC#N)c(=O)c2[nH]c(Cl)nc21.
What is the InChIKey of 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile?
The InChIKey is NCXNEFKJJQAIOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClN5O2/c1-2-3-6-9-20-12-11(18-14(16)19-12)13(22)21(15(20)23)10-7-4-5-8-17/h2-7,9-10H2,1H3,(H,18,19).
What are the key properties of 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile?
5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile has a molecular weight of 337.81 g/mol, XLogP of 2.42, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(8-chloro-2,6-dioxo-3-pentyl-7H-purin-1-yl)pentanenitrile is sourced from PubChem (CID 59395706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).