C12H11ClF2N2O — CID 59395776
2-(3-chloropropyl)-5-[(2,4-difluorophenyl)methyl]-1,3,4-oxadiazole (PubChem CID 59395776) has the molecular formula C12H11ClF2N2O and a molecular weight of 272.68 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-[(2,4-difluorophenyl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloropropyl)-5-[(2,4-difluorophenyl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 59395776 |
| Molecular Formula | C12H11ClF2N2O |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-(3-chloropropyl)-5-[(2,4-difluorophenyl)methyl]-1,3,4-oxadiazole |
| SMILES | Fc1ccc(Cc2nnc(CCCCl)o2)c(F)c1 |
| InChI | InChI=1S/C12H11ClF2N2O/c13-5-1-2-11-16-17-12(18-11)6-8-3-4-9(14)7-10(8)15/h3-4,7H,1-2,5-6H2 |
| InChIKey | WPTWHVQNBTXLFA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|