C15H26N2O4 — CID 59396014
tert-butyl N-[2-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]-2-oxoethyl]carbamate (PubChem CID 59396014) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is tert-butyl N-[2-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 59396014 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | tert-butyl N-[2-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]-2-oxoethyl]carbamate |
| SMILES | C=CC[C@H]1COC(C)(C)N1C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O4/c1-7-8-11-10-20-15(5,6)17(11)12(18)9-16-13(19)21-14(2,3)4/h7,11H,1,8-10H2,2-6H3,(H,16,19)/t11-/m0/s1 |
| InChIKey | OFXOXGYVZIPXDB-NSHDSACASA-N |
| XLogP | 2.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|