C18H19F3N2O3S — CID 59396080
5-[butylsulfonyl-(2,3,6-trifluorophenyl)methyl]-4-methylpyridine-2-carboxamide (PubChem CID 59396080) has the molecular formula C18H19F3N2O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is 5-[butylsulfonyl-(2,3,6-trifluorophenyl)methyl]-4-methylpyridine-2-carboxamide.
| Compound Name | 5-[butylsulfonyl-(2,3,6-trifluorophenyl)methyl]-4-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 59396080 |
| Molecular Formula | C18H19F3N2O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 5-[butylsulfonyl-(2,3,6-trifluorophenyl)methyl]-4-methylpyridine-2-carboxamide |
| SMILES | CCCCS(=O)(=O)C(c1cnc(C(N)=O)cc1C)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C18H19F3N2O3S/c1-3-4-7-27(25,26)17(15-12(19)5-6-13(20)16(15)21)11-9-23-14(18(22)24)8-10(11)2/h5-6,8-9,17H,3-4,7H2,1-2H3,(H2,22,24) |
| InChIKey | WAYIDEMMBJIADR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|