C16H23NO — CID 59396580
(1R)-1-(2-methoxycyclohexyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 59396580) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (1R)-1-(2-methoxycyclohexyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R)-1-(2-methoxycyclohexyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 59396580 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (1R)-1-(2-methoxycyclohexyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COC1CCCCC1[C@H]1NCCc2ccccc21 |
| InChI | InChI=1S/C16H23NO/c1-18-15-9-5-4-8-14(15)16-13-7-3-2-6-12(13)10-11-17-16/h2-3,6-7,14-17H,4-5,8-11H2,1H3/t14?,15?,16-/m0/s1 |
| InChIKey | RQPOBKTYCGFBNB-GPANFISMSA-N |
| XLogP | 3.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |