C24H28O7 — CID 59396904
(Z)-6-[(2S,4S,5R)-2-(2,3-dimethoxyphenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 59396904) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-2-(2,3-dimethoxyphenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-2-(2,3-dimethoxyphenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 59396904 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-2-(2,3-dimethoxyphenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | COc1cccc([C@H]2OC[C@@H](C/C=C\CCC(=O)O)[C@@H](c3ccccc3O)O2)c1OC |
| InChI | InChI=1S/C24H28O7/c1-28-20-13-8-11-18(23(20)29-2)24-30-15-16(9-4-3-5-14-21(26)27)22(31-24)17-10-6-7-12-19(17)25/h3-4,6-8,10-13,16,22,24-25H,5,9,14-15H2,1-2H3,(H,26,27)/b4-3-/t16-,22+,24+/m1/s1 |
| InChIKey | ZEIYSWNYKDQOPI-XXUMLZCDSA-N |
| XLogP | 4.62 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|