About 6-(3-aminoanilino)-1,3-dihydroindol-2-one
6-(3-aminoanilino)-1,3-dihydroindol-2-one (PubChem CID 59397049) has the molecular formula C14H13N3O
and a molecular weight of 239.28 g/mol. Its IUPAC name is 6-(3-aminoanilino)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 6-(3-aminoanilino)-1,3-dihydroindol-2-one |
| PubChem CID | 59397049 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 6-(3-aminoanilino)-1,3-dihydroindol-2-one |
| SMILES | Nc1cccc(Nc2ccc3c(c2)NC(=O)C3)c1 |
| InChI | InChI=1S/C14H13N3O/c15-10-2-1-3-11(7-10)16-12-5-4-9-6-14(18)17-13(9)8-12/h1-5,7-8,16H,6,15H2,(H,17,18) |
| InChIKey | IEFHMBNACJXCJG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-aminoanilino)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-aminoanilino)-1,3-dihydroindol-2-one?
The IUPAC name of 6-(3-aminoanilino)-1,3-dihydroindol-2-one (CID 59397049) is 6-(3-aminoanilino)-1,3-dihydroindol-2-one.
What is the SMILES notation for 6-(3-aminoanilino)-1,3-dihydroindol-2-one?
The canonical SMILES for 6-(3-aminoanilino)-1,3-dihydroindol-2-one is Nc1cccc(Nc2ccc3c(c2)NC(=O)C3)c1.
What is the InChIKey of 6-(3-aminoanilino)-1,3-dihydroindol-2-one?
The InChIKey is IEFHMBNACJXCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O/c15-10-2-1-3-11(7-10)16-12-5-4-9-6-14(18)17-13(9)8-12/h1-5,7-8,16H,6,15H2,(H,17,18).
What are the key properties of 6-(3-aminoanilino)-1,3-dihydroindol-2-one?
6-(3-aminoanilino)-1,3-dihydroindol-2-one has a molecular weight of 239.28 g/mol, XLogP of 2.51, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-aminoanilino)-1,3-dihydroindol-2-one is sourced from PubChem (CID 59397049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).